2-(2,3-dihydro-1H-inden-5-ylmethylamino)butanedioic acid

C14H17NO4 — CID 115144370

IUPAC2-(2,3-dihydro-1H-inden-5-ylmethylamino)butanedioic acid
SMILESO=C(O)CC(NCc1ccc2c(c1)CCC2)C(=O)O
InChIInChI=1S/C14H17NO4/c16-13(17)7-12(14(18)19)15-8-9-4-5-10-2-1-3-11(10)6-9/h4-6,12,15H,1-3,7-8H2,(H,16,17)(H,18,19)
InChIKeyDBLQUMMXZNTPDJ-UHFFFAOYSA-N
MW263.29 g/mol
LogP1.19
Rot. Bonds6

About 2-(2,3-dihydro-1H-inden-5-ylmethylamino)butanedioic acid

2-(2,3-dihydro-1H-inden-5-ylmethylamino)butanedioic acid (PubChem CID 115144370) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-5-ylmethylamino)butanedioic acid.

Molecular Properties

Compound Name2-(2,3-dihydro-1H-inden-5-ylmethylamino)butanedioic acid
PubChem CID115144370
Molecular FormulaC14H17NO4
Molecular Weight263.29 g/mol
Exact Mass263.12
IUPAC Name2-(2,3-dihydro-1H-inden-5-ylmethylamino)butanedioic acid
SMILESO=C(O)CC(NCc1ccc2c(c1)CCC2)C(=O)O
InChIInChI=1S/C14H17NO4/c16-13(17)7-12(14(18)19)15-8-9-4-5-10-2-1-3-11(10)6-9/h4-6,12,15H,1-3,7-8H2,(H,16,17)(H,18,19)
InChIKeyDBLQUMMXZNTPDJ-UHFFFAOYSA-N
XLogP1.19
TPSA86.63 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.29
LogP ≤ 51.19
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2-(2,3-dihydro-1H-inden-5-ylmethylamino)butanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,3-dihydro-1H-inden-5-ylmethylamino)butanedioic acid?
The IUPAC name of 2-(2,3-dihydro-1H-inden-5-ylmethylamino)butanedioic acid (CID 115144370) is 2-(2,3-dihydro-1H-inden-5-ylmethylamino)butanedioic acid.
What is the SMILES notation for 2-(2,3-dihydro-1H-inden-5-ylmethylamino)butanedioic acid?
The canonical SMILES for 2-(2,3-dihydro-1H-inden-5-ylmethylamino)butanedioic acid is O=C(O)CC(NCc1ccc2c(c1)CCC2)C(=O)O.
What is the InChIKey of 2-(2,3-dihydro-1H-inden-5-ylmethylamino)butanedioic acid?
The InChIKey is DBLQUMMXZNTPDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO4/c16-13(17)7-12(14(18)19)15-8-9-4-5-10-2-1-3-11(10)6-9/h4-6,12,15H,1-3,7-8H2,(H,16,17)(H,18,19).
What are the key properties of 2-(2,3-dihydro-1H-inden-5-ylmethylamino)butanedioic acid?
2-(2,3-dihydro-1H-inden-5-ylmethylamino)butanedioic acid has a molecular weight of 263.29 g/mol, XLogP of 1.19, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydro-1H-inden-5-ylmethylamino)butanedioic acid is sourced from PubChem (CID 115144370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).