C13H19NO2 — CID 65314706
2-(2,3-dihydro-1H-inden-5-ylmethylamino)propane-1,3-diol (PubChem CID 65314706) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-5-ylmethylamino)propane-1,3-diol.
| Compound Name | 2-(2,3-dihydro-1H-inden-5-ylmethylamino)propane-1,3-diol |
|---|---|
| PubChem CID | 65314706 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-5-ylmethylamino)propane-1,3-diol |
| SMILES | OCC(CO)NCc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C13H19NO2/c15-8-13(9-16)14-7-10-4-5-11-2-1-3-12(11)6-10/h4-6,13-16H,1-3,7-9H2 |
| InChIKey | LXVNBZNTFCWCLH-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |