C22H27NO2 — CID 122045767
5-phenyl-4-(5,6,7,8-tetrahydronaphthalen-2-ylmethylamino)pentanoic acid (PubChem CID 122045767) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is 5-phenyl-4-(5,6,7,8-tetrahydronaphthalen-2-ylmethylamino)pentanoic acid.
| Compound Name | 5-phenyl-4-(5,6,7,8-tetrahydronaphthalen-2-ylmethylamino)pentanoic acid |
|---|---|
| PubChem CID | 122045767 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 5-phenyl-4-(5,6,7,8-tetrahydronaphthalen-2-ylmethylamino)pentanoic acid |
| SMILES | O=C(O)CCC(Cc1ccccc1)NCc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C22H27NO2/c24-22(25)13-12-21(15-17-6-2-1-3-7-17)23-16-18-10-11-19-8-4-5-9-20(19)14-18/h1-3,6-7,10-11,14,21,23H,4-5,8-9,12-13,15-16H2,(H,24,25) |
| InChIKey | KAQCNPKQLPROEF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |