C18H20BrNO2 — CID 120512028
4-[(4-bromophenyl)methylamino]-5-phenylpentanoic acid (PubChem CID 120512028) has the molecular formula C18H20BrNO2 and a molecular weight of 362.27 g/mol. Its IUPAC name is 4-[(4-bromophenyl)methylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[(4-bromophenyl)methylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 120512028 |
| Molecular Formula | C18H20BrNO2 |
| Molecular Weight | 362.27 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 4-[(4-bromophenyl)methylamino]-5-phenylpentanoic acid |
| SMILES | O=C(O)CCC(Cc1ccccc1)NCc1ccc(Br)cc1 |
| InChI | InChI=1S/C18H20BrNO2/c19-16-8-6-15(7-9-16)13-20-17(10-11-18(21)22)12-14-4-2-1-3-5-14/h1-9,17,20H,10-13H2,(H,21,22) |
| InChIKey | BCQYOLQBUHNWMH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.27 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |