C18H20ClNO2 — CID 120511981
4-[(2-chlorophenyl)methylamino]-5-phenylpentanoic acid (PubChem CID 120511981) has the molecular formula C18H20ClNO2 and a molecular weight of 317.82 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[(2-chlorophenyl)methylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 120511981 |
| Molecular Formula | C18H20ClNO2 |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 4-[(2-chlorophenyl)methylamino]-5-phenylpentanoic acid |
| SMILES | O=C(O)CCC(Cc1ccccc1)NCc1ccccc1Cl |
| InChI | InChI=1S/C18H20ClNO2/c19-17-9-5-4-8-15(17)13-20-16(10-11-18(21)22)12-14-6-2-1-3-7-14/h1-9,16,20H,10-13H2,(H,21,22) |
| InChIKey | MNDPSHVQNUZCST-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |