C21H22ClNO2S — CID 122045748
4-[(7-chloro-3-methyl-1-benzothiophen-2-yl)methylamino]-5-phenylpentanoic acid (PubChem CID 122045748) has the molecular formula C21H22ClNO2S and a molecular weight of 387.93 g/mol. Its IUPAC name is 4-[(7-chloro-3-methyl-1-benzothiophen-2-yl)methylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[(7-chloro-3-methyl-1-benzothiophen-2-yl)methylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122045748 |
| Molecular Formula | C21H22ClNO2S |
| Molecular Weight | 387.93 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 4-[(7-chloro-3-methyl-1-benzothiophen-2-yl)methylamino]-5-phenylpentanoic acid |
| SMILES | Cc1c(CNC(CCC(=O)O)Cc2ccccc2)sc2c(Cl)cccc12 |
| InChI | InChI=1S/C21H22ClNO2S/c1-14-17-8-5-9-18(22)21(17)26-19(14)13-23-16(10-11-20(24)25)12-15-6-3-2-4-7-15/h2-9,16,23H,10-13H2,1H3,(H,24,25) |
| InChIKey | FXKXHRCDHWONGB-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.93 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |