C19H22FNO2 — CID 120511962
4-[(4-fluoro-3-methylphenyl)methylamino]-5-phenylpentanoic acid (PubChem CID 120511962) has the molecular formula C19H22FNO2 and a molecular weight of 315.39 g/mol. Its IUPAC name is 4-[(4-fluoro-3-methylphenyl)methylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[(4-fluoro-3-methylphenyl)methylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 120511962 |
| Molecular Formula | C19H22FNO2 |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 4-[(4-fluoro-3-methylphenyl)methylamino]-5-phenylpentanoic acid |
| SMILES | Cc1cc(CNC(CCC(=O)O)Cc2ccccc2)ccc1F |
| InChI | InChI=1S/C19H22FNO2/c1-14-11-16(7-9-18(14)20)13-21-17(8-10-19(22)23)12-15-5-3-2-4-6-15/h2-7,9,11,17,21H,8,10,12-13H2,1H3,(H,22,23) |
| InChIKey | AQDIRBRYYFGKFL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |