C19H21F2NO3 — CID 120511928
4-[[4-(difluoromethoxy)phenyl]methylamino]-5-phenylpentanoic acid (PubChem CID 120511928) has the molecular formula C19H21F2NO3 and a molecular weight of 349.38 g/mol. Its IUPAC name is 4-[[4-(difluoromethoxy)phenyl]methylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[[4-(difluoromethoxy)phenyl]methylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 120511928 |
| Molecular Formula | C19H21F2NO3 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 4-[[4-(difluoromethoxy)phenyl]methylamino]-5-phenylpentanoic acid |
| SMILES | O=C(O)CCC(Cc1ccccc1)NCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C19H21F2NO3/c20-19(21)25-17-9-6-15(7-10-17)13-22-16(8-11-18(23)24)12-14-4-2-1-3-5-14/h1-7,9-10,16,19,22H,8,11-13H2,(H,23,24) |
| InChIKey | FARMMSUKXOJPCX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |