C19H20ClF2NO3 — CID 120511969
4-[[3-chloro-4-(difluoromethoxy)phenyl]methylamino]-5-phenylpentanoic acid (PubChem CID 120511969) has the molecular formula C19H20ClF2NO3 and a molecular weight of 383.82 g/mol. Its IUPAC name is 4-[[3-chloro-4-(difluoromethoxy)phenyl]methylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[[3-chloro-4-(difluoromethoxy)phenyl]methylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 120511969 |
| Molecular Formula | C19H20ClF2NO3 |
| Molecular Weight | 383.82 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 4-[[3-chloro-4-(difluoromethoxy)phenyl]methylamino]-5-phenylpentanoic acid |
| SMILES | O=C(O)CCC(Cc1ccccc1)NCc1ccc(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C19H20ClF2NO3/c20-16-11-14(6-8-17(16)26-19(21)22)12-23-15(7-9-18(24)25)10-13-4-2-1-3-5-13/h1-6,8,11,15,19,23H,7,9-10,12H2,(H,24,25) |
| InChIKey | MDABJXCHZBRKEP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.82 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |