4-[(3,4-dimethoxyphenyl)methylamino]-5-phenylpentanoic acid

C20H25NO4 — CID 120511858

IUPAC4-[(3,4-dimethoxyphenyl)methylamino]-5-phenylpentanoic acid
SMILESCOc1ccc(CNC(CCC(=O)O)Cc2ccccc2)cc1OC
InChIInChI=1S/C20H25NO4/c1-24-18-10-8-16(13-19(18)25-2)14-21-17(9-11-20(22)23)12-15-6-4-3-5-7-15/h3-8,10,13,17,21H,9,11-12,14H2,1-2H3,(H,22,23)
InChIKeyXOZKMFCUFAJLCU-UHFFFAOYSA-N
MW343.42 g/mol
LogP3.27
Rot. Bonds10

About 4-[(3,4-dimethoxyphenyl)methylamino]-5-phenylpentanoic acid

4-[(3,4-dimethoxyphenyl)methylamino]-5-phenylpentanoic acid (PubChem CID 120511858) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is 4-[(3,4-dimethoxyphenyl)methylamino]-5-phenylpentanoic acid.

Molecular Properties

Compound Name4-[(3,4-dimethoxyphenyl)methylamino]-5-phenylpentanoic acid
PubChem CID120511858
Molecular FormulaC20H25NO4
Molecular Weight343.42 g/mol
Exact Mass343.18
IUPAC Name4-[(3,4-dimethoxyphenyl)methylamino]-5-phenylpentanoic acid
SMILESCOc1ccc(CNC(CCC(=O)O)Cc2ccccc2)cc1OC
InChIInChI=1S/C20H25NO4/c1-24-18-10-8-16(13-19(18)25-2)14-21-17(9-11-20(22)23)12-15-6-4-3-5-7-15/h3-8,10,13,17,21H,9,11-12,14H2,1-2H3,(H,22,23)
InChIKeyXOZKMFCUFAJLCU-UHFFFAOYSA-N
XLogP3.27
TPSA67.79 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds10
Heavy Atoms25
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500343.42
LogP ≤ 53.27
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-[(3,4-dimethoxyphenyl)methylamino]-5-phenylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(3,4-dimethoxyphenyl)methylamino]-5-phenylpentanoic acid?
The IUPAC name of 4-[(3,4-dimethoxyphenyl)methylamino]-5-phenylpentanoic acid (CID 120511858) is 4-[(3,4-dimethoxyphenyl)methylamino]-5-phenylpentanoic acid.
What is the SMILES notation for 4-[(3,4-dimethoxyphenyl)methylamino]-5-phenylpentanoic acid?
The canonical SMILES for 4-[(3,4-dimethoxyphenyl)methylamino]-5-phenylpentanoic acid is COc1ccc(CNC(CCC(=O)O)Cc2ccccc2)cc1OC.
What is the InChIKey of 4-[(3,4-dimethoxyphenyl)methylamino]-5-phenylpentanoic acid?
The InChIKey is XOZKMFCUFAJLCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25NO4/c1-24-18-10-8-16(13-19(18)25-2)14-21-17(9-11-20(22)23)12-15-6-4-3-5-7-15/h3-8,10,13,17,21H,9,11-12,14H2,1-2H3,(H,22,23).
What are the key properties of 4-[(3,4-dimethoxyphenyl)methylamino]-5-phenylpentanoic acid?
4-[(3,4-dimethoxyphenyl)methylamino]-5-phenylpentanoic acid has a molecular weight of 343.42 g/mol, XLogP of 3.27, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,4-dimethoxyphenyl)methylamino]-5-phenylpentanoic acid is sourced from PubChem (CID 120511858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).