C18H23NO3 — CID 59712221
2-(benzylamino)-3-(3,4-dimethoxyphenyl)propan-1-ol (PubChem CID 59712221) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-(benzylamino)-3-(3,4-dimethoxyphenyl)propan-1-ol.
| Compound Name | 2-(benzylamino)-3-(3,4-dimethoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 59712221 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 2-(benzylamino)-3-(3,4-dimethoxyphenyl)propan-1-ol |
| SMILES | COc1ccc(CC(CO)NCc2ccccc2)cc1OC |
| InChI | InChI=1S/C18H23NO3/c1-21-17-9-8-15(11-18(17)22-2)10-16(13-20)19-12-14-6-4-3-5-7-14/h3-9,11,16,19-20H,10,12-13H2,1-2H3 |
| InChIKey | HMQCBWVZEHKDLD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |