C20H28ClNO4 — CID 2987379
2-[[4-(2-hydroxy-2-phenylethoxy)-3-methoxyphenyl]methylamino]butan-1-ol;hydrochloride (PubChem CID 2987379) has the molecular formula C20H28ClNO4 and a molecular weight of 381.90 g/mol. Its IUPAC name is 2-[[4-(2-hydroxy-2-phenylethoxy)-3-methoxyphenyl]methylamino]butan-1-ol;hydrochloride.
| Compound Name | 2-[[4-(2-hydroxy-2-phenylethoxy)-3-methoxyphenyl]methylamino]butan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 2987379 |
| Molecular Formula | C20H28ClNO4 |
| Molecular Weight | 381.90 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 2-[[4-(2-hydroxy-2-phenylethoxy)-3-methoxyphenyl]methylamino]butan-1-ol;hydrochloride |
| SMILES | CCC(CO)NCc1ccc(OCC(O)c2ccccc2)c(OC)c1.Cl |
| InChI | InChI=1S/C20H27NO4.ClH/c1-3-17(13-22)21-12-15-9-10-19(20(11-15)24-2)25-14-18(23)16-7-5-4-6-8-16;/h4-11,17-18,21-23H,3,12-14H2,1-2H3;1H |
| InChIKey | ZQKWQTCQJZKVSR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.90 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |