C17H24ClNO3S — CID 17290099
2-[[3-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methylamino]butan-1-ol;hydrochloride (PubChem CID 17290099) has the molecular formula C17H24ClNO3S and a molecular weight of 357.90 g/mol. Its IUPAC name is 2-[[3-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methylamino]butan-1-ol;hydrochloride.
| Compound Name | 2-[[3-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methylamino]butan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 17290099 |
| Molecular Formula | C17H24ClNO3S |
| Molecular Weight | 357.90 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 2-[[3-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methylamino]butan-1-ol;hydrochloride |
| SMILES | CCC(CO)NCc1ccc(OCc2cccs2)c(OC)c1.Cl |
| InChI | InChI=1S/C17H23NO3S.ClH/c1-3-14(11-19)18-10-13-6-7-16(17(9-13)20-2)21-12-15-5-4-8-22-15;/h4-9,14,18-19H,3,10-12H2,1-2H3;1H |
| InChIKey | JBOUZWSUGKEEHH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.90 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |