C16H20ClNO2S — CID 6463534
N-[[3-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]prop-2-en-1-amine;hydrochloride (PubChem CID 6463534) has the molecular formula C16H20ClNO2S and a molecular weight of 325.86 g/mol. Its IUPAC name is N-[[3-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]prop-2-en-1-amine;hydrochloride.
| Compound Name | N-[[3-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]prop-2-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 6463534 |
| Molecular Formula | C16H20ClNO2S |
| Molecular Weight | 325.86 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | N-[[3-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]prop-2-en-1-amine;hydrochloride |
| SMILES | C=CCNCc1ccc(OCc2cccs2)c(OC)c1.Cl |
| InChI | InChI=1S/C16H19NO2S.ClH/c1-3-8-17-11-13-6-7-15(16(10-13)18-2)19-12-14-5-4-9-20-14;/h3-7,9-10,17H,1,8,11-12H2,2H3;1H |
| InChIKey | GMPKBVYTJUMFBE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.86 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|