C17H20Cl2N2O2 — CID 17294027
N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-methoxyphenyl]methyl]prop-2-en-1-amine;hydrochloride (PubChem CID 17294027) has the molecular formula C17H20Cl2N2O2 and a molecular weight of 355.27 g/mol. Its IUPAC name is N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-methoxyphenyl]methyl]prop-2-en-1-amine;hydrochloride.
| Compound Name | N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-methoxyphenyl]methyl]prop-2-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17294027 |
| Molecular Formula | C17H20Cl2N2O2 |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-methoxyphenyl]methyl]prop-2-en-1-amine;hydrochloride |
| SMILES | C=CCNCc1ccc(OCc2ccc(Cl)nc2)c(OC)c1.Cl |
| InChI | InChI=1S/C17H19ClN2O2.ClH/c1-3-8-19-10-13-4-6-15(16(9-13)21-2)22-12-14-5-7-17(18)20-11-14;/h3-7,9,11,19H,1,8,10,12H2,2H3;1H |
| InChIKey | ROGHPSMFIMFNQS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|