C22H23ClN2O2 — CID 7582626
(1R)-N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-methoxyphenyl]methyl]-1-phenylethanamine (PubChem CID 7582626) has the molecular formula C22H23ClN2O2 and a molecular weight of 382.89 g/mol. Its IUPAC name is (1R)-N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-methoxyphenyl]methyl]-1-phenylethanamine.
| Compound Name | (1R)-N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-methoxyphenyl]methyl]-1-phenylethanamine |
|---|---|
| PubChem CID | 7582626 |
| Molecular Formula | C22H23ClN2O2 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | (1R)-N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-methoxyphenyl]methyl]-1-phenylethanamine |
| SMILES | COc1cc(CN[C@H](C)c2ccccc2)ccc1OCc1ccc(Cl)nc1 |
| InChI | InChI=1S/C22H23ClN2O2/c1-16(19-6-4-3-5-7-19)24-13-17-8-10-20(21(12-17)26-2)27-15-18-9-11-22(23)25-14-18/h3-12,14,16,24H,13,15H2,1-2H3/t16-/m1/s1 |
| InChIKey | MWGJJDLLQRNXDN-MRXNPFEDSA-N |
| XLogP | 5.17 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|