C22H24Cl2N2O2 — CID 44665971
[4-[(6-chloro-3-pyridinyl)methoxy]-3-methoxyphenyl]methyl-(1-phenylethyl)azanium chloride (PubChem CID 44665971) has the molecular formula C22H24Cl2N2O2 and a molecular weight of 419.35 g/mol. Its IUPAC name is [4-[(6-chloro-3-pyridinyl)methoxy]-3-methoxyphenyl]methyl-(1-phenylethyl)azanium chloride.
| Compound Name | [4-[(6-chloro-3-pyridinyl)methoxy]-3-methoxyphenyl]methyl-(1-phenylethyl)azanium chloride |
|---|---|
| PubChem CID | 44665971 |
| Molecular Formula | C22H24Cl2N2O2 |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | [4-[(6-chloro-3-pyridinyl)methoxy]-3-methoxyphenyl]methyl-(1-phenylethyl)azanium chloride |
| SMILES | COc1cc(C[NH2+]C(C)c2ccccc2)ccc1OCc1ccc(Cl)nc1.[Cl-] |
| InChI | InChI=1S/C22H23ClN2O2.ClH/c1-16(19-6-4-3-5-7-19)24-13-17-8-10-20(21(12-17)26-2)27-15-18-9-11-22(23)25-14-18;/h3-12,14,16,24H,13,15H2,1-2H3;1H |
| InChIKey | SRKYJABYVDOUMG-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 47.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|