C18H26Cl3N3O2 — CID 44665781
2-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-methoxyphenyl]methylazaniumyl]ethyl-dimethylazanium dichloride (PubChem CID 44665781) has the molecular formula C18H26Cl3N3O2 and a molecular weight of 422.78 g/mol. Its IUPAC name is 2-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-methoxyphenyl]methylazaniumyl]ethyl-dimethylazanium dichloride.
| Compound Name | 2-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-methoxyphenyl]methylazaniumyl]ethyl-dimethylazanium dichloride |
|---|---|
| PubChem CID | 44665781 |
| Molecular Formula | C18H26Cl3N3O2 |
| Molecular Weight | 422.78 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 2-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-methoxyphenyl]methylazaniumyl]ethyl-dimethylazanium dichloride |
| SMILES | COc1cc(C[NH2+]CC[NH+](C)C)ccc1OCc1ccc(Cl)nc1.[Cl-].[Cl-] |
| InChI | InChI=1S/C18H24ClN3O2.2ClH/c1-22(2)9-8-20-11-14-4-6-16(17(10-14)23-3)24-13-15-5-7-18(19)21-12-15;;/h4-7,10,12,20H,8-9,11,13H2,1-3H3;2*1H |
| InChIKey | BAWKFFXADBSUOC-UHFFFAOYSA-N |
| XLogP | -5.46 |
| TPSA | 52.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.78 |
| LogP ≤ 5 | -5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|