C20H28Cl3FN2O2 — CID 44666640
3-[[4-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methylazaniumyl]propyl-dimethylazanium dichloride (PubChem CID 44666640) has the molecular formula C20H28Cl3FN2O2 and a molecular weight of 453.81 g/mol. Its IUPAC name is 3-[[4-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methylazaniumyl]propyl-dimethylazanium dichloride.
| Compound Name | 3-[[4-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methylazaniumyl]propyl-dimethylazanium dichloride |
|---|---|
| PubChem CID | 44666640 |
| Molecular Formula | C20H28Cl3FN2O2 |
| Molecular Weight | 453.81 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 3-[[4-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methylazaniumyl]propyl-dimethylazanium dichloride |
| SMILES | COc1cc(C[NH2+]CCC[NH+](C)C)ccc1OCc1ccc(F)cc1Cl.[Cl-].[Cl-] |
| InChI | InChI=1S/C20H26ClFN2O2.2ClH/c1-24(2)10-4-9-23-13-15-5-8-19(20(11-15)25-3)26-14-16-6-7-17(22)12-18(16)21;;/h5-8,11-12,23H,4,9-10,13-14H2,1-3H3;2*1H |
| InChIKey | LDRFETYMSVLMNL-UHFFFAOYSA-N |
| XLogP | -4.33 |
| TPSA | 39.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.81 |
| LogP ≤ 5 | -4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|