C20H28ClFN2O2+2 — CID 2227355
3-[[4-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methylazaniumyl]propyl-dimethylazanium (PubChem CID 2227355) has the molecular formula C20H28ClFN2O2+2 and a molecular weight of 382.91 g/mol. Its IUPAC name is 3-[[4-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methylazaniumyl]propyl-dimethylazanium.
| Compound Name | 3-[[4-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methylazaniumyl]propyl-dimethylazanium |
|---|---|
| PubChem CID | 2227355 |
| Molecular Formula | C20H28ClFN2O2+2 |
| Molecular Weight | 382.91 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 3-[[4-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methylazaniumyl]propyl-dimethylazanium |
| SMILES | COc1cc(C[NH2+]CCC[NH+](C)C)ccc1OCc1ccc(F)cc1Cl |
| InChI | InChI=1S/C20H26ClFN2O2/c1-24(2)10-4-9-23-13-15-5-8-19(20(11-15)25-3)26-14-16-6-7-17(22)12-18(16)21/h5-8,11-12,23H,4,9-10,13-14H2,1-3H3/p+2 |
| InChIKey | ISJAYBNGYSGENB-UHFFFAOYSA-P |
| XLogP | 1.66 |
| TPSA | 39.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.91 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|