C18H21ClFNO3 — CID 51435290
(2R)-1-[[4-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methylamino]propan-2-ol (PubChem CID 51435290) has the molecular formula C18H21ClFNO3 and a molecular weight of 353.82 g/mol. Its IUPAC name is (2R)-1-[[4-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methylamino]propan-2-ol.
| Compound Name | (2R)-1-[[4-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methylamino]propan-2-ol |
|---|---|
| PubChem CID | 51435290 |
| Molecular Formula | C18H21ClFNO3 |
| Molecular Weight | 353.82 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | (2R)-1-[[4-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methylamino]propan-2-ol |
| SMILES | COc1cc(CNC[C@@H](C)O)ccc1OCc1ccc(F)cc1Cl |
| InChI | InChI=1S/C18H21ClFNO3/c1-12(22)9-21-10-13-3-6-17(18(7-13)23-2)24-11-14-4-5-15(20)8-16(14)19/h3-8,12,21-22H,9-11H2,1-2H3/t12-/m1/s1 |
| InChIKey | VCYPPKGRVIXHRV-GFCCVEGCSA-N |
| XLogP | 3.54 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.82 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |