C19H22ClNO2 — CID 122045862
4-[(3-chloro-4-methylphenyl)methylamino]-5-phenylpentanoic acid (PubChem CID 122045862) has the molecular formula C19H22ClNO2 and a molecular weight of 331.84 g/mol. Its IUPAC name is 4-[(3-chloro-4-methylphenyl)methylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[(3-chloro-4-methylphenyl)methylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122045862 |
| Molecular Formula | C19H22ClNO2 |
| Molecular Weight | 331.84 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 4-[(3-chloro-4-methylphenyl)methylamino]-5-phenylpentanoic acid |
| SMILES | Cc1ccc(CNC(CCC(=O)O)Cc2ccccc2)cc1Cl |
| InChI | InChI=1S/C19H22ClNO2/c1-14-7-8-16(12-18(14)20)13-21-17(9-10-19(22)23)11-15-5-3-2-4-6-15/h2-8,12,17,21H,9-11,13H2,1H3,(H,22,23) |
| InChIKey | HEDYFIMEAIUJNH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.84 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |