C21H25NO2 — CID 122045700
4-[(4-cyclopropylphenyl)methylamino]-5-phenylpentanoic acid (PubChem CID 122045700) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 4-[(4-cyclopropylphenyl)methylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[(4-cyclopropylphenyl)methylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122045700 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 4-[(4-cyclopropylphenyl)methylamino]-5-phenylpentanoic acid |
| SMILES | O=C(O)CCC(Cc1ccccc1)NCc1ccc(C2CC2)cc1 |
| InChI | InChI=1S/C21H25NO2/c23-21(24)13-12-20(14-16-4-2-1-3-5-16)22-15-17-6-8-18(9-7-17)19-10-11-19/h1-9,19-20,22H,10-15H2,(H,23,24) |
| InChIKey | VTJZFUHZLUZMBU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |