C16H18ClNO2S — CID 120511860
4-[(5-chlorothiophen-2-yl)methylamino]-5-phenylpentanoic acid (PubChem CID 120511860) has the molecular formula C16H18ClNO2S and a molecular weight of 323.84 g/mol. Its IUPAC name is 4-[(5-chlorothiophen-2-yl)methylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[(5-chlorothiophen-2-yl)methylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 120511860 |
| Molecular Formula | C16H18ClNO2S |
| Molecular Weight | 323.84 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 4-[(5-chlorothiophen-2-yl)methylamino]-5-phenylpentanoic acid |
| SMILES | O=C(O)CCC(Cc1ccccc1)NCc1ccc(Cl)s1 |
| InChI | InChI=1S/C16H18ClNO2S/c17-15-8-7-14(21-15)11-18-13(6-9-16(19)20)10-12-4-2-1-3-5-12/h1-5,7-8,13,18H,6,9-11H2,(H,19,20) |
| InChIKey | STMHJUGXQDUYSI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.84 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |