C16H15Cl2NO3S — CID 120547272
4-[(2,5-dichlorothiophene-3-carbonyl)amino]-5-phenylpentanoic acid (PubChem CID 120547272) has the molecular formula C16H15Cl2NO3S and a molecular weight of 372.27 g/mol. Its IUPAC name is 4-[(2,5-dichlorothiophene-3-carbonyl)amino]-5-phenylpentanoic acid.
| Compound Name | 4-[(2,5-dichlorothiophene-3-carbonyl)amino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 120547272 |
| Molecular Formula | C16H15Cl2NO3S |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | 4-[(2,5-dichlorothiophene-3-carbonyl)amino]-5-phenylpentanoic acid |
| SMILES | O=C(O)CCC(Cc1ccccc1)NC(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C16H15Cl2NO3S/c17-13-9-12(15(18)23-13)16(22)19-11(6-7-14(20)21)8-10-4-2-1-3-5-10/h1-5,9,11H,6-8H2,(H,19,22)(H,20,21) |
| InChIKey | QSMWIFCAGOFNAB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |