4-[(2,3-dimethylbenzoyl)amino]-5-phenylpentanoic acid

C20H23NO3 — CID 120547076

IUPAC4-[(2,3-dimethylbenzoyl)amino]-5-phenylpentanoic acid
SMILESCc1cccc(C(=O)NC(CCC(=O)O)Cc2ccccc2)c1C
InChIInChI=1S/C20H23NO3/c1-14-7-6-10-18(15(14)2)20(24)21-17(11-12-19(22)23)13-16-8-4-3-5-9-16/h3-10,17H,11-13H2,1-2H3,(H,21,24)(H,22,23)
InChIKeyWTYLHBYQQSETQE-UHFFFAOYSA-N
MW325.41 g/mol
LogP3.51
Rot. Bonds7

About 4-[(2,3-dimethylbenzoyl)amino]-5-phenylpentanoic acid

4-[(2,3-dimethylbenzoyl)amino]-5-phenylpentanoic acid (PubChem CID 120547076) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is 4-[(2,3-dimethylbenzoyl)amino]-5-phenylpentanoic acid.

Molecular Properties

Compound Name4-[(2,3-dimethylbenzoyl)amino]-5-phenylpentanoic acid
PubChem CID120547076
Molecular FormulaC20H23NO3
Molecular Weight325.41 g/mol
Exact Mass325.17
IUPAC Name4-[(2,3-dimethylbenzoyl)amino]-5-phenylpentanoic acid
SMILESCc1cccc(C(=O)NC(CCC(=O)O)Cc2ccccc2)c1C
InChIInChI=1S/C20H23NO3/c1-14-7-6-10-18(15(14)2)20(24)21-17(11-12-19(22)23)13-16-8-4-3-5-9-16/h3-10,17H,11-13H2,1-2H3,(H,21,24)(H,22,23)
InChIKeyWTYLHBYQQSETQE-UHFFFAOYSA-N
XLogP3.51
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500325.41
LogP ≤ 53.51
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-[(2,3-dimethylbenzoyl)amino]-5-phenylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(2,3-dimethylbenzoyl)amino]-5-phenylpentanoic acid?
The IUPAC name of 4-[(2,3-dimethylbenzoyl)amino]-5-phenylpentanoic acid (CID 120547076) is 4-[(2,3-dimethylbenzoyl)amino]-5-phenylpentanoic acid.
What is the SMILES notation for 4-[(2,3-dimethylbenzoyl)amino]-5-phenylpentanoic acid?
The canonical SMILES for 4-[(2,3-dimethylbenzoyl)amino]-5-phenylpentanoic acid is Cc1cccc(C(=O)NC(CCC(=O)O)Cc2ccccc2)c1C.
What is the InChIKey of 4-[(2,3-dimethylbenzoyl)amino]-5-phenylpentanoic acid?
The InChIKey is WTYLHBYQQSETQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO3/c1-14-7-6-10-18(15(14)2)20(24)21-17(11-12-19(22)23)13-16-8-4-3-5-9-16/h3-10,17H,11-13H2,1-2H3,(H,21,24)(H,22,23).
What are the key properties of 4-[(2,3-dimethylbenzoyl)amino]-5-phenylpentanoic acid?
4-[(2,3-dimethylbenzoyl)amino]-5-phenylpentanoic acid has a molecular weight of 325.41 g/mol, XLogP of 3.51, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,3-dimethylbenzoyl)amino]-5-phenylpentanoic acid is sourced from PubChem (CID 120547076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).