C15H24N2O — CID 113498869
(2R)-2-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methylamino]butan-1-ol (PubChem CID 113498869) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is (2R)-2-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methylamino]butan-1-ol.
| Compound Name | (2R)-2-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methylamino]butan-1-ol |
|---|---|
| PubChem CID | 113498869 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | (2R)-2-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methylamino]butan-1-ol |
| SMILES | CC[C@H](CO)NCc1ccc2c(c1)CCCN2C |
| InChI | InChI=1S/C15H24N2O/c1-3-14(11-18)16-10-12-6-7-15-13(9-12)5-4-8-17(15)2/h6-7,9,14,16,18H,3-5,8,10-11H2,1-2H3/t14-/m1/s1 |
| InChIKey | NGOJYGMCZBNLTK-CQSZACIVSA-N |
| XLogP | 1.93 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|