C14H22N2O2 — CID 114078771
3-methoxy-2-[(1-methyl-2,3-dihydroindol-5-yl)methylamino]propan-1-ol (PubChem CID 114078771) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 3-methoxy-2-[(1-methyl-2,3-dihydroindol-5-yl)methylamino]propan-1-ol.
| Compound Name | 3-methoxy-2-[(1-methyl-2,3-dihydroindol-5-yl)methylamino]propan-1-ol |
|---|---|
| PubChem CID | 114078771 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 3-methoxy-2-[(1-methyl-2,3-dihydroindol-5-yl)methylamino]propan-1-ol |
| SMILES | COCC(CO)NCc1ccc2c(c1)CCN2C |
| InChI | InChI=1S/C14H22N2O2/c1-16-6-5-12-7-11(3-4-14(12)16)8-15-13(9-17)10-18-2/h3-4,7,13,15,17H,5-6,8-10H2,1-2H3 |
| InChIKey | PNKAMLCYNOKSJW-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|