C16H26N2O2 — CID 106156668
4-methoxy-3-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methylamino]butan-1-ol (PubChem CID 106156668) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 4-methoxy-3-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methylamino]butan-1-ol.
| Compound Name | 4-methoxy-3-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methylamino]butan-1-ol |
|---|---|
| PubChem CID | 106156668 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 4-methoxy-3-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methylamino]butan-1-ol |
| SMILES | COCC(CCO)NCc1ccc2c(c1)CCCN2C |
| InChI | InChI=1S/C16H26N2O2/c1-18-8-3-4-14-10-13(5-6-16(14)18)11-17-15(7-9-19)12-20-2/h5-6,10,15,17,19H,3-4,7-9,11-12H2,1-2H3 |
| InChIKey | QRYQIYSSNVVTTJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|