C13H18FNO4 — CID 106162247
2-fluoro-4-[[(4-hydroxy-1-methoxybutan-2-yl)amino]methyl]benzoic acid (PubChem CID 106162247) has the molecular formula C13H18FNO4 and a molecular weight of 271.29 g/mol. Its IUPAC name is 2-fluoro-4-[[(4-hydroxy-1-methoxybutan-2-yl)amino]methyl]benzoic acid.
| Compound Name | 2-fluoro-4-[[(4-hydroxy-1-methoxybutan-2-yl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 106162247 |
| Molecular Formula | C13H18FNO4 |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 2-fluoro-4-[[(4-hydroxy-1-methoxybutan-2-yl)amino]methyl]benzoic acid |
| SMILES | COCC(CCO)NCc1ccc(C(=O)O)c(F)c1 |
| InChI | InChI=1S/C13H18FNO4/c1-19-8-10(4-5-16)15-7-9-2-3-11(13(17)18)12(14)6-9/h2-3,6,10,15-16H,4-5,7-8H2,1H3,(H,17,18) |
| InChIKey | RDRWDEWXZNIYOQ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |