C12H15BrFNO4 — CID 106162699
2-bromo-3-fluoro-4-[(4-hydroxy-1-methoxybutan-2-yl)amino]benzoic acid (PubChem CID 106162699) has the molecular formula C12H15BrFNO4 and a molecular weight of 336.16 g/mol. Its IUPAC name is 2-bromo-3-fluoro-4-[(4-hydroxy-1-methoxybutan-2-yl)amino]benzoic acid.
| Compound Name | 2-bromo-3-fluoro-4-[(4-hydroxy-1-methoxybutan-2-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 106162699 |
| Molecular Formula | C12H15BrFNO4 |
| Molecular Weight | 336.16 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 2-bromo-3-fluoro-4-[(4-hydroxy-1-methoxybutan-2-yl)amino]benzoic acid |
| SMILES | COCC(CCO)Nc1ccc(C(=O)O)c(Br)c1F |
| InChI | InChI=1S/C12H15BrFNO4/c1-19-6-7(4-5-16)15-9-3-2-8(12(17)18)10(13)11(9)14/h2-3,7,15-16H,4-6H2,1H3,(H,17,18) |
| InChIKey | ZYYONFAFECEIPZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.16 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |