C13H16F3NO4 — CID 106162705
4-[(4-hydroxy-1-methoxybutan-2-yl)amino]-2-(trifluoromethyl)benzoic acid (PubChem CID 106162705) has the molecular formula C13H16F3NO4 and a molecular weight of 307.27 g/mol. Its IUPAC name is 4-[(4-hydroxy-1-methoxybutan-2-yl)amino]-2-(trifluoromethyl)benzoic acid.
| Compound Name | 4-[(4-hydroxy-1-methoxybutan-2-yl)amino]-2-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 106162705 |
| Molecular Formula | C13H16F3NO4 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 4-[(4-hydroxy-1-methoxybutan-2-yl)amino]-2-(trifluoromethyl)benzoic acid |
| SMILES | COCC(CCO)Nc1ccc(C(=O)O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H16F3NO4/c1-21-7-9(4-5-18)17-8-2-3-10(12(19)20)11(6-8)13(14,15)16/h2-3,6,9,17-18H,4-5,7H2,1H3,(H,19,20) |
| InChIKey | QVZYPZQGCOAFMA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |