C13H16F3NO3 — CID 79245507
4-[(1-hydroxy-3-methylbutan-2-yl)amino]-2-(trifluoromethyl)benzoic acid (PubChem CID 79245507) has the molecular formula C13H16F3NO3 and a molecular weight of 291.27 g/mol. Its IUPAC name is 4-[(1-hydroxy-3-methylbutan-2-yl)amino]-2-(trifluoromethyl)benzoic acid.
| Compound Name | 4-[(1-hydroxy-3-methylbutan-2-yl)amino]-2-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 79245507 |
| Molecular Formula | C13H16F3NO3 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 4-[(1-hydroxy-3-methylbutan-2-yl)amino]-2-(trifluoromethyl)benzoic acid |
| SMILES | CC(C)C(CO)Nc1ccc(C(=O)O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H16F3NO3/c1-7(2)11(6-18)17-8-3-4-9(12(19)20)10(5-8)13(14,15)16/h3-5,7,11,17-18H,6H2,1-2H3,(H,19,20) |
| InChIKey | VUHKIXHBWQUXEU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |