C12H16ClNO4 — CID 106162697
3-chloro-4-[(4-hydroxy-1-methoxybutan-2-yl)amino]benzoic acid (PubChem CID 106162697) has the molecular formula C12H16ClNO4 and a molecular weight of 273.72 g/mol. Its IUPAC name is 3-chloro-4-[(4-hydroxy-1-methoxybutan-2-yl)amino]benzoic acid.
| Compound Name | 3-chloro-4-[(4-hydroxy-1-methoxybutan-2-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 106162697 |
| Molecular Formula | C12H16ClNO4 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 3-chloro-4-[(4-hydroxy-1-methoxybutan-2-yl)amino]benzoic acid |
| SMILES | COCC(CCO)Nc1ccc(C(=O)O)cc1Cl |
| InChI | InChI=1S/C12H16ClNO4/c1-18-7-9(4-5-15)14-11-3-2-8(12(16)17)6-10(11)13/h2-3,6,9,14-15H,4-5,7H2,1H3,(H,16,17) |
| InChIKey | FVLSTLNJNHOZRK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |