C12H16FNO4 — CID 114152202
2-fluoro-6-[(4-hydroxy-1-methoxybutan-2-yl)amino]benzoic acid (PubChem CID 114152202) has the molecular formula C12H16FNO4 and a molecular weight of 257.26 g/mol. Its IUPAC name is 2-fluoro-6-[(4-hydroxy-1-methoxybutan-2-yl)amino]benzoic acid.
| Compound Name | 2-fluoro-6-[(4-hydroxy-1-methoxybutan-2-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 114152202 |
| Molecular Formula | C12H16FNO4 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 2-fluoro-6-[(4-hydroxy-1-methoxybutan-2-yl)amino]benzoic acid |
| SMILES | COCC(CCO)Nc1cccc(F)c1C(=O)O |
| InChI | InChI=1S/C12H16FNO4/c1-18-7-8(5-6-15)14-10-4-2-3-9(13)11(10)12(16)17/h2-4,8,14-15H,5-7H2,1H3,(H,16,17) |
| InChIKey | UPQGDKGFCOUKRP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |