C18H22N2 — CID 81350665
(1R)-N-[(1-methyl-2,3-dihydroindol-5-yl)methyl]-1-phenylethanamine (PubChem CID 81350665) has the molecular formula C18H22N2 and a molecular weight of 266.39 g/mol. Its IUPAC name is (1R)-N-[(1-methyl-2,3-dihydroindol-5-yl)methyl]-1-phenylethanamine.
| Compound Name | (1R)-N-[(1-methyl-2,3-dihydroindol-5-yl)methyl]-1-phenylethanamine |
|---|---|
| PubChem CID | 81350665 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | (1R)-N-[(1-methyl-2,3-dihydroindol-5-yl)methyl]-1-phenylethanamine |
| SMILES | C[C@@H](NCc1ccc2c(c1)CCN2C)c1ccccc1 |
| InChI | InChI=1S/C18H22N2/c1-14(16-6-4-3-5-7-16)19-13-15-8-9-18-17(12-15)10-11-20(18)2/h3-9,12,14,19H,10-11,13H2,1-2H3/t14-/m1/s1 |
| InChIKey | PRRRDYSHNBRFCG-CQSZACIVSA-N |
| XLogP | 3.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|