C18H21FN2 — CID 81351126
(1S)-1-(4-fluorophenyl)-N-[(1-methyl-2,3-dihydroindol-5-yl)methyl]ethanamine (PubChem CID 81351126) has the molecular formula C18H21FN2 and a molecular weight of 284.38 g/mol. Its IUPAC name is (1S)-1-(4-fluorophenyl)-N-[(1-methyl-2,3-dihydroindol-5-yl)methyl]ethanamine.
| Compound Name | (1S)-1-(4-fluorophenyl)-N-[(1-methyl-2,3-dihydroindol-5-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 81351126 |
| Molecular Formula | C18H21FN2 |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | (1S)-1-(4-fluorophenyl)-N-[(1-methyl-2,3-dihydroindol-5-yl)methyl]ethanamine |
| SMILES | C[C@H](NCc1ccc2c(c1)CCN2C)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H21FN2/c1-13(15-4-6-17(19)7-5-15)20-12-14-3-8-18-16(11-14)9-10-21(18)2/h3-8,11,13,20H,9-10,12H2,1-2H3/t13-/m0/s1 |
| InChIKey | KXLCMEZDORZDRV-ZDUSSCGKSA-N |
| XLogP | 3.67 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|