C18H19F3N2O — CID 109380215
2-[(1-methyl-2,3-dihydroindol-5-yl)methylamino]-2-(3,4,5-trifluorophenyl)ethanol (PubChem CID 109380215) has the molecular formula C18H19F3N2O and a molecular weight of 336.36 g/mol. Its IUPAC name is 2-[(1-methyl-2,3-dihydroindol-5-yl)methylamino]-2-(3,4,5-trifluorophenyl)ethanol.
| Compound Name | 2-[(1-methyl-2,3-dihydroindol-5-yl)methylamino]-2-(3,4,5-trifluorophenyl)ethanol |
|---|---|
| PubChem CID | 109380215 |
| Molecular Formula | C18H19F3N2O |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 2-[(1-methyl-2,3-dihydroindol-5-yl)methylamino]-2-(3,4,5-trifluorophenyl)ethanol |
| SMILES | CN1CCc2cc(CNC(CO)c3cc(F)c(F)c(F)c3)ccc21 |
| InChI | InChI=1S/C18H19F3N2O/c1-23-5-4-12-6-11(2-3-17(12)23)9-22-16(10-24)13-7-14(19)18(21)15(20)8-13/h2-3,6-8,16,22,24H,4-5,9-10H2,1H3 |
| InChIKey | FRXKAYYAMQQQKN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|