C16H15ClF3NO2 — CID 109380212
2-[(3-chloro-4-methoxyphenyl)methylamino]-2-(3,4,5-trifluorophenyl)ethanol (PubChem CID 109380212) has the molecular formula C16H15ClF3NO2 and a molecular weight of 345.75 g/mol. Its IUPAC name is 2-[(3-chloro-4-methoxyphenyl)methylamino]-2-(3,4,5-trifluorophenyl)ethanol.
| Compound Name | 2-[(3-chloro-4-methoxyphenyl)methylamino]-2-(3,4,5-trifluorophenyl)ethanol |
|---|---|
| PubChem CID | 109380212 |
| Molecular Formula | C16H15ClF3NO2 |
| Molecular Weight | 345.75 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 2-[(3-chloro-4-methoxyphenyl)methylamino]-2-(3,4,5-trifluorophenyl)ethanol |
| SMILES | COc1ccc(CNC(CO)c2cc(F)c(F)c(F)c2)cc1Cl |
| InChI | InChI=1S/C16H15ClF3NO2/c1-23-15-3-2-9(4-11(15)17)7-21-14(8-22)10-5-12(18)16(20)13(19)6-10/h2-6,14,21-22H,7-8H2,1H3 |
| InChIKey | ZHUUBDNJDAVDJP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.75 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|