C16H16F2N2 — CID 62096658
2,4-difluoro-N-[(1-methyl-2,3-dihydroindol-5-yl)methyl]aniline (PubChem CID 62096658) has the molecular formula C16H16F2N2 and a molecular weight of 274.31 g/mol. Its IUPAC name is 2,4-difluoro-N-[(1-methyl-2,3-dihydroindol-5-yl)methyl]aniline.
| Compound Name | 2,4-difluoro-N-[(1-methyl-2,3-dihydroindol-5-yl)methyl]aniline |
|---|---|
| PubChem CID | 62096658 |
| Molecular Formula | C16H16F2N2 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 2,4-difluoro-N-[(1-methyl-2,3-dihydroindol-5-yl)methyl]aniline |
| SMILES | CN1CCc2cc(CNc3ccc(F)cc3F)ccc21 |
| InChI | InChI=1S/C16H16F2N2/c1-20-7-6-12-8-11(2-5-16(12)20)10-19-15-4-3-13(17)9-14(15)18/h2-5,8-9,19H,6-7,10H2,1H3 |
| InChIKey | FQLRZUUMLXJIAI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |