C16H17BrN2 — CID 55034920
2-bromo-N-[(1-methyl-2,3-dihydroindol-5-yl)methyl]aniline (PubChem CID 55034920) has the molecular formula C16H17BrN2 and a molecular weight of 317.23 g/mol. Its IUPAC name is 2-bromo-N-[(1-methyl-2,3-dihydroindol-5-yl)methyl]aniline.
| Compound Name | 2-bromo-N-[(1-methyl-2,3-dihydroindol-5-yl)methyl]aniline |
|---|---|
| PubChem CID | 55034920 |
| Molecular Formula | C16H17BrN2 |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 2-bromo-N-[(1-methyl-2,3-dihydroindol-5-yl)methyl]aniline |
| SMILES | CN1CCc2cc(CNc3ccccc3Br)ccc21 |
| InChI | InChI=1S/C16H17BrN2/c1-19-9-8-13-10-12(6-7-16(13)19)11-18-15-5-3-2-4-14(15)17/h2-7,10,18H,8-9,11H2,1H3 |
| InChIKey | SDVHWPVMRCZYTL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |