C11H16N2O — CID 82706033
N-methoxy-1-(1-methyl-2,3-dihydroindol-5-yl)methanamine (PubChem CID 82706033) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is N-methoxy-1-(1-methyl-2,3-dihydroindol-5-yl)methanamine.
| Compound Name | N-methoxy-1-(1-methyl-2,3-dihydroindol-5-yl)methanamine |
|---|---|
| PubChem CID | 82706033 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | N-methoxy-1-(1-methyl-2,3-dihydroindol-5-yl)methanamine |
| SMILES | CONCc1ccc2c(c1)CCN2C |
| InChI | InChI=1S/C11H16N2O/c1-13-6-5-10-7-9(8-12-14-2)3-4-11(10)13/h3-4,7,12H,5-6,8H2,1-2H3 |
| InChIKey | STWHEZVSCKFQJX-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|