C24H24N2O5S2 — CID 54121910
2-(dibenzofuran-2-ylsulfonylamino)-5-[(4-methylphenyl)sulfanylamino]pentanoic acid (PubChem CID 54121910) has the molecular formula C24H24N2O5S2 and a molecular weight of 484.60 g/mol. Its IUPAC name is 2-(dibenzofuran-2-ylsulfonylamino)-5-[(4-methylphenyl)sulfanylamino]pentanoic acid.
| Compound Name | 2-(dibenzofuran-2-ylsulfonylamino)-5-[(4-methylphenyl)sulfanylamino]pentanoic acid |
|---|---|
| PubChem CID | 54121910 |
| Molecular Formula | C24H24N2O5S2 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | 2-(dibenzofuran-2-ylsulfonylamino)-5-[(4-methylphenyl)sulfanylamino]pentanoic acid |
| SMILES | Cc1ccc(SNCCCC(NS(=O)(=O)c2ccc3oc4ccccc4c3c2)C(=O)O)cc1 |
| InChI | InChI=1S/C24H24N2O5S2/c1-16-8-10-17(11-9-16)32-25-14-4-6-21(24(27)28)26-33(29,30)18-12-13-23-20(15-18)19-5-2-3-7-22(19)31-23/h2-3,5,7-13,15,21,25-26H,4,6,14H2,1H3,(H,27,28) |
| InChIKey | NOHPAHUIWXBUGM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|