C37H26O3S2 — CID 129199524
2-[3-[4-[4-(4-methylphenyl)sulfonylsulfanylphenyl]phenyl]phenyl]dibenzofuran (PubChem CID 129199524) has the molecular formula C37H26O3S2 and a molecular weight of 582.75 g/mol. Its IUPAC name is 2-[3-[4-[4-(4-methylphenyl)sulfonylsulfanylphenyl]phenyl]phenyl]dibenzofuran.
| Compound Name | 2-[3-[4-[4-(4-methylphenyl)sulfonylsulfanylphenyl]phenyl]phenyl]dibenzofuran |
|---|---|
| PubChem CID | 129199524 |
| Molecular Formula | C37H26O3S2 |
| Molecular Weight | 582.75 g/mol |
| Exact Mass | 582.13 |
| IUPAC Name | 2-[3-[4-[4-(4-methylphenyl)sulfonylsulfanylphenyl]phenyl]phenyl]dibenzofuran |
| SMILES | Cc1ccc(S(=O)(=O)Sc2ccc(-c3ccc(-c4cccc(-c5ccc6oc7ccccc7c6c5)c4)cc3)cc2)cc1 |
| InChI | InChI=1S/C37H26O3S2/c1-25-9-20-33(21-10-25)42(38,39)41-32-18-15-27(16-19-32)26-11-13-28(14-12-26)29-5-4-6-30(23-29)31-17-22-37-35(24-31)34-7-2-3-8-36(34)40-37/h2-24H,1H3 |
| InChIKey | NUKNRUWESZEBHL-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.75 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|