C23H28N2O6S — CID 70165066
hydroxylamine;(2S)-5-phenyl-2-(6,7,8,9-tetrahydrodibenzofuran-3-ylsulfonylamino)pentanoic acid (PubChem CID 70165066) has the molecular formula C23H28N2O6S and a molecular weight of 460.55 g/mol. Its IUPAC name is hydroxylamine;(2S)-5-phenyl-2-(6,7,8,9-tetrahydrodibenzofuran-3-ylsulfonylamino)pentanoic acid.
| Compound Name | hydroxylamine;(2S)-5-phenyl-2-(6,7,8,9-tetrahydrodibenzofuran-3-ylsulfonylamino)pentanoic acid |
|---|---|
| PubChem CID | 70165066 |
| Molecular Formula | C23H28N2O6S |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | hydroxylamine;(2S)-5-phenyl-2-(6,7,8,9-tetrahydrodibenzofuran-3-ylsulfonylamino)pentanoic acid |
| SMILES | NO.O=C(O)[C@H](CCCc1ccccc1)NS(=O)(=O)c1ccc2c3c(oc2c1)CCCC3 |
| InChI | InChI=1S/C23H25NO5S.H3NO/c25-23(26)20(11-6-9-16-7-2-1-3-8-16)24-30(27,28)17-13-14-19-18-10-4-5-12-21(18)29-22(19)15-17;1-2/h1-3,7-8,13-15,20,24H,4-6,9-12H2,(H,25,26);2H,1H2/t20-;/m0./s1 |
| InChIKey | UWRXTARNMKZQKB-BDQAORGHSA-N |
| XLogP | 3.40 |
| TPSA | 142.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|