C23H24NO5S- — CID 56974954
7-[(1-carboxy-4-phenylbutyl)-sulfinatoamino]-1,2,3,4-tetrahydrodibenzofuran (PubChem CID 56974954) has the molecular formula C23H24NO5S- and a molecular weight of 426.51 g/mol. Its IUPAC name is 7-[(1-carboxy-4-phenylbutyl)-sulfinatoamino]-1,2,3,4-tetrahydrodibenzofuran.
| Compound Name | 7-[(1-carboxy-4-phenylbutyl)-sulfinatoamino]-1,2,3,4-tetrahydrodibenzofuran |
|---|---|
| PubChem CID | 56974954 |
| Molecular Formula | C23H24NO5S- |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 7-[(1-carboxy-4-phenylbutyl)-sulfinatoamino]-1,2,3,4-tetrahydrodibenzofuran |
| SMILES | O=C(O)C(CCCc1ccccc1)N(c1ccc2c3c(oc2c1)CCCC3)S(=O)[O-] |
| InChI | InChI=1S/C23H25NO5S/c25-23(26)20(11-6-9-16-7-2-1-3-8-16)24(30(27)28)17-13-14-19-18-10-4-5-12-21(18)29-22(19)15-17/h1-3,7-8,13-15,20H,4-6,9-12H2,(H,25,26)(H,27,28)/p-1 |
| InChIKey | HDFCUIMUPAZZIJ-UHFFFAOYSA-M |
| XLogP | 4.39 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|