C21H16NO5S2- — CID 57143804
2-[(1-carboxy-2-phenylethyl)-sulfinatoamino]phenoxathiine (PubChem CID 57143804) has the molecular formula C21H16NO5S2- and a molecular weight of 426.50 g/mol. Its IUPAC name is 2-[(1-carboxy-2-phenylethyl)-sulfinatoamino]phenoxathiine.
| Compound Name | 2-[(1-carboxy-2-phenylethyl)-sulfinatoamino]phenoxathiine |
|---|---|
| PubChem CID | 57143804 |
| Molecular Formula | C21H16NO5S2- |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | 2-[(1-carboxy-2-phenylethyl)-sulfinatoamino]phenoxathiine |
| SMILES | O=C(O)C(Cc1ccccc1)N(c1ccc2c(c1)Sc1ccccc1O2)S(=O)[O-] |
| InChI | InChI=1S/C21H17NO5S2/c23-21(24)16(12-14-6-2-1-3-7-14)22(29(25)26)15-10-11-18-20(13-15)28-19-9-5-4-8-17(19)27-18/h1-11,13,16H,12H2,(H,23,24)(H,25,26)/p-1 |
| InChIKey | BESXWJRLLRYIEF-UHFFFAOYSA-M |
| XLogP | 4.24 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|