About 3-[1,2-dicarboxyethyl(sulfinato)amino]phenoxathiine
3-[1,2-dicarboxyethyl(sulfinato)amino]phenoxathiine (PubChem CID 57155506) has the molecular formula C16H12NO7S2-
and a molecular weight of 394.41 g/mol. Its IUPAC name is 3-[1,2-dicarboxyethyl(sulfinato)amino]phenoxathiine.
Molecular Properties
| Compound Name | 3-[1,2-dicarboxyethyl(sulfinato)amino]phenoxathiine |
| PubChem CID | 57155506 |
| Molecular Formula | C16H12NO7S2- |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | 3-[1,2-dicarboxyethyl(sulfinato)amino]phenoxathiine |
| SMILES | O=C(O)CC(C(=O)O)N(c1ccc2c(c1)Oc1ccccc1S2)S(=O)[O-] |
| InChI | InChI=1S/C16H13NO7S2/c18-15(19)8-10(16(20)21)17(26(22)23)9-5-6-14-12(7-9)24-11-3-1-2-4-13(11)25-14/h1-7,10H,8H2,(H,18,19)(H,20,21)(H,22,23)/p-1 |
| InChIKey | KTMOTONHALJBAX-UHFFFAOYSA-M |
| XLogP | 2.47 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 3-[1,2-dicarboxyethyl(sulfinato)amino]phenoxathiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1,2-dicarboxyethyl(sulfinato)amino]phenoxathiine?
The IUPAC name of 3-[1,2-dicarboxyethyl(sulfinato)amino]phenoxathiine (CID 57155506) is 3-[1,2-dicarboxyethyl(sulfinato)amino]phenoxathiine.
What is the SMILES notation for 3-[1,2-dicarboxyethyl(sulfinato)amino]phenoxathiine?
The canonical SMILES for 3-[1,2-dicarboxyethyl(sulfinato)amino]phenoxathiine is O=C(O)CC(C(=O)O)N(c1ccc2c(c1)Oc1ccccc1S2)S(=O)[O-].
What is the InChIKey of 3-[1,2-dicarboxyethyl(sulfinato)amino]phenoxathiine?
The InChIKey is KTMOTONHALJBAX-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H13NO7S2/c18-15(19)8-10(16(20)21)17(26(22)23)9-5-6-14-12(7-9)24-11-3-1-2-4-13(11)25-14/h1-7,10H,8H2,(H,18,19)(H,20,21)(H,22,23)/p-1.
What are the key properties of 3-[1,2-dicarboxyethyl(sulfinato)amino]phenoxathiine?
3-[1,2-dicarboxyethyl(sulfinato)amino]phenoxathiine has a molecular weight of 394.41 g/mol, XLogP of 2.47, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1,2-dicarboxyethyl(sulfinato)amino]phenoxathiine is sourced from PubChem (CID 57155506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).