C22H19N2O6S2- — CID 57187007
2-[[1-carboxy-4-oxo-4-(thiophen-2-ylmethylamino)butyl]-sulfinatoamino]dibenzofuran (PubChem CID 57187007) has the molecular formula C22H19N2O6S2- and a molecular weight of 471.54 g/mol. Its IUPAC name is 2-[[1-carboxy-4-oxo-4-(thiophen-2-ylmethylamino)butyl]-sulfinatoamino]dibenzofuran.
| Compound Name | 2-[[1-carboxy-4-oxo-4-(thiophen-2-ylmethylamino)butyl]-sulfinatoamino]dibenzofuran |
|---|---|
| PubChem CID | 57187007 |
| Molecular Formula | C22H19N2O6S2- |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | 2-[[1-carboxy-4-oxo-4-(thiophen-2-ylmethylamino)butyl]-sulfinatoamino]dibenzofuran |
| SMILES | O=C(CCC(C(=O)O)N(c1ccc2oc3ccccc3c2c1)S(=O)[O-])NCc1cccs1 |
| InChI | InChI=1S/C22H20N2O6S2/c25-21(23-13-15-4-3-11-31-15)10-8-18(22(26)27)24(32(28)29)14-7-9-20-17(12-14)16-5-1-2-6-19(16)30-20/h1-7,9,11-12,18H,8,10,13H2,(H,23,25)(H,26,27)(H,28,29)/p-1 |
| InChIKey | FSKGGXMQIZCPPA-UHFFFAOYSA-M |
| XLogP | 3.80 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|