C28H24N2O7S2-2 — CID 57215711
2-[[1-carboxy-5-[naphthalen-1-yl(sulfinato)amino]pentyl]-sulfinatoamino]dibenzofuran (PubChem CID 57215711) has the molecular formula C28H24N2O7S2-2 and a molecular weight of 564.64 g/mol. Its IUPAC name is 2-[[1-carboxy-5-[naphthalen-1-yl(sulfinato)amino]pentyl]-sulfinatoamino]dibenzofuran.
| Compound Name | 2-[[1-carboxy-5-[naphthalen-1-yl(sulfinato)amino]pentyl]-sulfinatoamino]dibenzofuran |
|---|---|
| PubChem CID | 57215711 |
| Molecular Formula | C28H24N2O7S2-2 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.10 |
| IUPAC Name | 2-[[1-carboxy-5-[naphthalen-1-yl(sulfinato)amino]pentyl]-sulfinatoamino]dibenzofuran |
| SMILES | O=C(O)C(CCCCN(c1cccc2ccccc12)S(=O)[O-])N(c1ccc2oc3ccccc3c2c1)S(=O)[O-] |
| InChI | InChI=1S/C28H26N2O7S2/c31-28(32)25(12-5-6-17-29(38(33)34)24-13-7-9-19-8-1-2-10-21(19)24)30(39(35)36)20-15-16-27-23(18-20)22-11-3-4-14-26(22)37-27/h1-4,7-11,13-16,18,25H,5-6,12,17H2,(H,31,32)(H,33,34)(H,35,36)/p-2 |
| InChIKey | FDUQXBYNMNEOLP-UHFFFAOYSA-L |
| XLogP | 5.26 |
| TPSA | 137.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|